C12H18N2O3 — CID 89396634
1-pentyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 89396634) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-pentyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-pentyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 89396634 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-pentyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1C(=O)NC(=O)N(CCCCC)C1=O |
| InChI | InChI=1S/C12H18N2O3/c1-3-5-6-8-14-11(16)9(7-4-2)10(15)13-12(14)17/h4,9H,2-3,5-8H2,1H3,(H,13,15,17) |
| InChIKey | VTNKFZNVRQYSIK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|