About (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid
(4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 89396678) has the molecular formula C6H9NO3S
and a molecular weight of 175.21 g/mol. Its IUPAC name is (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 89396678 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | CCOC1=N[C@H](C(=O)O)CS1 |
| InChI | InChI=1S/C6H9NO3S/c1-2-10-6-7-4(3-11-6)5(8)9/h4H,2-3H2,1H3,(H,8,9)/t4-/m0/s1 |
| InChIKey | SYPDIWOLCSLGAS-BYPYZUCNSA-N |
| XLogP | 0.58 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The IUPAC name of (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid (CID 89396678) is (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid is CCOC1=N[C@H](C(=O)O)CS1.
What is the InChIKey of (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
The InChIKey is SYPDIWOLCSLGAS-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H9NO3S/c1-2-10-6-7-4(3-11-6)5(8)9/h4H,2-3H2,1H3,(H,8,9)/t4-/m0/s1.
What are the key properties of (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid?
(4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid has a molecular weight of 175.21 g/mol, XLogP of 0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-ethoxy-4,5-dihydro-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 89396678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).