About 1-methoxy-2-methylpropane;palladium;2-phenylethanamine
1-methoxy-2-methylpropane;palladium;2-phenylethanamine (PubChem CID 89396703) has the molecular formula C13H22NOPd-
and a molecular weight of 314.74 g/mol. Its IUPAC name is 1-methoxy-2-methylpropane;palladium;2-phenylethanamine.
Molecular Properties
| Compound Name | 1-methoxy-2-methylpropane;palladium;2-phenylethanamine |
| PubChem CID | 89396703 |
| Molecular Formula | C13H22NOPd- |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-methoxy-2-methylpropane;palladium;2-phenylethanamine |
| SMILES | COCC(C)C.NCCc1[c-]cccc1.[Pd] |
| InChI | InChI=1S/C8H10N.C5H12O.Pd/c9-7-6-8-4-2-1-3-5-8;1-5(2)4-6-3;/h1-4H,6-7,9H2;5H,4H2,1-3H3;/q-1;; |
| InChIKey | LBDZJRRKDHQZHD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-methylpropane;palladium;2-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-methylpropane;palladium;2-phenylethanamine?
The IUPAC name of 1-methoxy-2-methylpropane;palladium;2-phenylethanamine (CID 89396703) is 1-methoxy-2-methylpropane;palladium;2-phenylethanamine.
What is the SMILES notation for 1-methoxy-2-methylpropane;palladium;2-phenylethanamine?
The canonical SMILES for 1-methoxy-2-methylpropane;palladium;2-phenylethanamine is COCC(C)C.NCCc1[c-]cccc1.[Pd].
What is the InChIKey of 1-methoxy-2-methylpropane;palladium;2-phenylethanamine?
The InChIKey is LBDZJRRKDHQZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N.C5H12O.Pd/c9-7-6-8-4-2-1-3-5-8;1-5(2)4-6-3;/h1-4H,6-7,9H2;5H,4H2,1-3H3;/q-1;;.
What are the key properties of 1-methoxy-2-methylpropane;palladium;2-phenylethanamine?
1-methoxy-2-methylpropane;palladium;2-phenylethanamine has a molecular weight of 314.74 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-methylpropane;palladium;2-phenylethanamine is sourced from PubChem (CID 89396703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).