About 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene
7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene (PubChem CID 89396709) has the molecular formula C11H8O
and a molecular weight of 156.18 g/mol. Its IUPAC name is 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene.
Analyze 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene?
The IUPAC name of 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene (CID 89396709) is 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene.
What is the SMILES notation for 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene?
The canonical SMILES for 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene is C1=CC2=C3C=CC=C3OCC2=C1.
What is the InChIKey of 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene?
The InChIKey is YUXMFIYXJHXMQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O/c1-3-8-7-12-11-6-2-5-10(11)9(8)4-1/h1-6H,7H2.
What are the key properties of 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene?
7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene has a molecular weight of 156.18 g/mol, XLogP of 2.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxatricyclo[7.3.0.02,6]dodeca-1,3,5,9,11-pentaene is sourced from PubChem (CID 89396709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).