C8H16O3 — CID 89396945
(2R,3R,4R)-2-hydroxy-3,4-dimethylhexanoic acid (PubChem CID 89396945) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2R,3R,4R)-2-hydroxy-3,4-dimethylhexanoic acid.
| Compound Name | (2R,3R,4R)-2-hydroxy-3,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 89396945 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2R,3R,4R)-2-hydroxy-3,4-dimethylhexanoic acid |
| SMILES | CC[C@@H](C)[C@@H](C)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C8H16O3/c1-4-5(2)6(3)7(9)8(10)11/h5-7,9H,4H2,1-3H3,(H,10,11)/t5-,6-,7-/m1/s1 |
| InChIKey | MFAQNEKFQPASLR-FSDSQADBSA-N |
| XLogP | 1.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |