C9H11ClN2O2 — CID 89396975
6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxine-5,8-diamine (PubChem CID 89396975) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxine-5,8-diamine.
| Compound Name | 6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxine-5,8-diamine |
|---|---|
| PubChem CID | 89396975 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 6-chloro-3-methyl-2,3-dihydro-1,4-benzodioxine-5,8-diamine |
| SMILES | CC1COc2c(N)cc(Cl)c(N)c2O1 |
| InChI | InChI=1S/C9H11ClN2O2/c1-4-3-13-8-6(11)2-5(10)7(12)9(8)14-4/h2,4H,3,11-12H2,1H3 |
| InChIKey | OSKMEDYFKKCZBV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|