C12H19NO2Se — CID 89396995
1-(2,5-dimethoxy-3-methylselanylphenyl)propan-2-amine (PubChem CID 89396995) has the molecular formula C12H19NO2Se and a molecular weight of 288.25 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-3-methylselanylphenyl)propan-2-amine.
| Compound Name | 1-(2,5-dimethoxy-3-methylselanylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 89396995 |
| Molecular Formula | C12H19NO2Se |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 1-(2,5-dimethoxy-3-methylselanylphenyl)propan-2-amine |
| SMILES | COc1cc(CC(C)N)c(OC)c([Se]C)c1 |
| InChI | InChI=1S/C12H19NO2Se/c1-8(13)5-9-6-10(14-2)7-11(16-4)12(9)15-3/h6-8H,5,13H2,1-4H3 |
| InChIKey | WFKLYMSMWXBGMF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|