C9H12N2O2 — CID 89397007
(3S)-3-methyl-2,3-dihydro-1,4-benzodioxine-5,8-diamine (PubChem CID 89397007) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (3S)-3-methyl-2,3-dihydro-1,4-benzodioxine-5,8-diamine.
| Compound Name | (3S)-3-methyl-2,3-dihydro-1,4-benzodioxine-5,8-diamine |
|---|---|
| PubChem CID | 89397007 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (3S)-3-methyl-2,3-dihydro-1,4-benzodioxine-5,8-diamine |
| SMILES | C[C@H]1COc2c(N)ccc(N)c2O1 |
| InChI | InChI=1S/C9H12N2O2/c1-5-4-12-8-6(10)2-3-7(11)9(8)13-5/h2-3,5H,4,10-11H2,1H3/t5-/m0/s1 |
| InChIKey | FKJJDQVYOLYUOI-YFKPBYRVSA-N |
| XLogP | 1.01 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|