About (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane
(2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane (PubChem CID 89397464) has the molecular formula C10H20OS
and a molecular weight of 188.34 g/mol. Its IUPAC name is (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane.
Molecular Properties
| Compound Name | (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane |
| PubChem CID | 89397464 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane |
| SMILES | CCSC1CC(C)(C)[C@@H](CC)O1 |
| InChI | InChI=1S/C10H20OS/c1-5-8-10(3,4)7-9(11-8)12-6-2/h8-9H,5-7H2,1-4H3/t8-,9?/m1/s1 |
| InChIKey | PZSOGZRSJMKJAN-VEDVMXKPSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane?
The IUPAC name of (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane (CID 89397464) is (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane.
What is the SMILES notation for (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane?
The canonical SMILES for (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane is CCSC1CC(C)(C)[C@@H](CC)O1.
What is the InChIKey of (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane?
The InChIKey is PZSOGZRSJMKJAN-VEDVMXKPSA-N. The full InChI is InChI=1S/C10H20OS/c1-5-8-10(3,4)7-9(11-8)12-6-2/h8-9H,5-7H2,1-4H3/t8-,9?/m1/s1.
What are the key properties of (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane?
(2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane has a molecular weight of 188.34 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-ethyl-5-ethylsulfanyl-3,3-dimethyloxolane is sourced from PubChem (CID 89397464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).