C18H31NO — CID 89397596
(1R,2S,5R)-5-methyl-N-(3-methylidenecyclohexyl)-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 89397596) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is (1R,2S,5R)-5-methyl-N-(3-methylidenecyclohexyl)-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | (1R,2S,5R)-5-methyl-N-(3-methylidenecyclohexyl)-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 89397596 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | (1R,2S,5R)-5-methyl-N-(3-methylidenecyclohexyl)-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | C=C1CCCC(NC(=O)[C@@H]2C[C@H](C)CC[C@H]2C(C)C)C1 |
| InChI | InChI=1S/C18H31NO/c1-12(2)16-9-8-14(4)11-17(16)18(20)19-15-7-5-6-13(3)10-15/h12,14-17H,3,5-11H2,1-2,4H3,(H,19,20)/t14-,15?,16+,17-/m1/s1 |
| InChIKey | WSIRAGQRBOPRMU-KFIMKLJYSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|