About 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one
4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one (PubChem CID 89397598) has the molecular formula C9H15NOS
and a molecular weight of 185.29 g/mol. Its IUPAC name is 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one.
Molecular Properties
| Compound Name | 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one |
| PubChem CID | 89397598 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one |
| SMILES | CCC(C)N1CCSC=CC1=O |
| InChI | InChI=1S/C9H15NOS/c1-3-8(2)10-5-7-12-6-4-9(10)11/h4,6,8H,3,5,7H2,1-2H3 |
| InChIKey | OQJGUCPKIHHPQO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one?
The IUPAC name of 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one (CID 89397598) is 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one.
What is the SMILES notation for 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one?
The canonical SMILES for 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one is CCC(C)N1CCSC=CC1=O.
What is the InChIKey of 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one?
The InChIKey is OQJGUCPKIHHPQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NOS/c1-3-8(2)10-5-7-12-6-4-9(10)11/h4,6,8H,3,5,7H2,1-2H3.
What are the key properties of 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one?
4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one has a molecular weight of 185.29 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-2,3-dihydro-1,4-thiazepin-5-one is sourced from PubChem (CID 89397598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).