C13H25N — CID 89397686
1,2,2,6,6-pentamethyl-4-prop-1-en-2-ylpiperidine (PubChem CID 89397686) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-prop-1-en-2-ylpiperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4-prop-1-en-2-ylpiperidine |
|---|---|
| PubChem CID | 89397686 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-prop-1-en-2-ylpiperidine |
| SMILES | C=C(C)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C13H25N/c1-10(2)11-8-12(3,4)14(7)13(5,6)9-11/h11H,1,8-9H2,2-7H3 |
| InChIKey | AZMPFINCOIVQPK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|