C20H22FN — CID 89397961
15-(2-fluoroethyl)-7-methyltetracyclo[11.3.1.02,11.04,9]heptadeca-2(11),3,5,7,9,14-hexaen-3-amine (PubChem CID 89397961) has the molecular formula C20H22FN and a molecular weight of 295.40 g/mol. Its IUPAC name is 15-(2-fluoroethyl)-7-methyltetracyclo[11.3.1.02,11.04,9]heptadeca-2(11),3,5,7,9,14-hexaen-3-amine.
| Compound Name | 15-(2-fluoroethyl)-7-methyltetracyclo[11.3.1.02,11.04,9]heptadeca-2(11),3,5,7,9,14-hexaen-3-amine |
|---|---|
| PubChem CID | 89397961 |
| Molecular Formula | C20H22FN |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 15-(2-fluoroethyl)-7-methyltetracyclo[11.3.1.02,11.04,9]heptadeca-2(11),3,5,7,9,14-hexaen-3-amine |
| SMILES | Cc1ccc2c(N)c3c(cc2c1)CC1C=C(CCF)CC3C1 |
| InChI | InChI=1S/C20H22FN/c1-12-2-3-18-15(6-12)11-17-10-14-7-13(4-5-21)8-16(9-14)19(17)20(18)22/h2-3,6-7,11,14,16H,4-5,8-10,22H2,1H3 |
| InChIKey | SULXTIFRRYKMAZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|