About 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole
5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole (PubChem CID 89398307) has the molecular formula C8H7ClN2O
and a molecular weight of 182.61 g/mol. Its IUPAC name is 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole |
| PubChem CID | 89398307 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole |
| SMILES | Cc1cc(Cl)c(C)c2nonc12 |
| InChI | InChI=1S/C8H7ClN2O/c1-4-3-6(9)5(2)8-7(4)10-12-11-8/h3H,1-2H3 |
| InChIKey | AVSISYVHFHOQIO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diazox_B(3)', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole?
The IUPAC name of 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole (CID 89398307) is 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole.
What is the SMILES notation for 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole?
The canonical SMILES for 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole is Cc1cc(Cl)c(C)c2nonc12.
What is the InChIKey of 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole?
The InChIKey is AVSISYVHFHOQIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O/c1-4-3-6(9)5(2)8-7(4)10-12-11-8/h3H,1-2H3.
What are the key properties of 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole?
5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole has a molecular weight of 182.61 g/mol, XLogP of 2.49, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4,7-dimethyl-2,1,3-benzoxadiazole is sourced from PubChem (CID 89398307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).