C19H16N4O5S — CID 8939831
N'-[(2R)-2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide (PubChem CID 8939831) has the molecular formula C19H16N4O5S and a molecular weight of 412.43 g/mol. Its IUPAC name is N'-[(2R)-2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide.
| Compound Name | N'-[(2R)-2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 8939831 |
| Molecular Formula | C19H16N4O5S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N'-[(2R)-2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide |
| SMILES | C[C@@H](Sc1nnc(-c2ccc3c(c2)OCO3)o1)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16N4O5S/c1-11(16(24)20-21-17(25)12-5-3-2-4-6-12)29-19-23-22-18(28-19)13-7-8-14-15(9-13)27-10-26-14/h2-9,11H,10H2,1H3,(H,20,24)(H,21,25)/t11-/m1/s1 |
| InChIKey | NYRMXIALBPIIEB-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|