C8H14O — CID 89398682
1,1,2,2,3,3,4,4,5,5-decadeuterio-6-(methoxymethylidene)cyclohexane (PubChem CID 89398682) has the molecular formula C8H14O and a molecular weight of 136.26 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decadeuterio-6-(methoxymethylidene)cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decadeuterio-6-(methoxymethylidene)cyclohexane |
|---|---|
| PubChem CID | 89398682 |
| Molecular Formula | C8H14O |
| Molecular Weight | 136.26 g/mol |
| Exact Mass | 136.17 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decadeuterio-6-(methoxymethylidene)cyclohexane |
| SMILES | [2H]C1([2H])C(=COC)C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C8H14O/c1-9-7-8-5-3-2-4-6-8/h7H,2-6H2,1H3/i2D2,3D2,4D2,5D2,6D2 |
| InChIKey | XSYNCAAZZTYJQK-DMFASMMLSA-N |
| XLogP | 2.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|