C11H21N3O — CID 89398987
(2E,4E)-4-amino-2-methyl-1-[2-(methylamino)ethylamino]hepta-2,4,6-trien-1-ol (PubChem CID 89398987) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is (2E,4E)-4-amino-2-methyl-1-[2-(methylamino)ethylamino]hepta-2,4,6-trien-1-ol.
| Compound Name | (2E,4E)-4-amino-2-methyl-1-[2-(methylamino)ethylamino]hepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 89398987 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (2E,4E)-4-amino-2-methyl-1-[2-(methylamino)ethylamino]hepta-2,4,6-trien-1-ol |
| SMILES | C=C/C=C(N)\C=C(/C)C(O)NCCNC |
| InChI | InChI=1S/C11H21N3O/c1-4-5-10(12)8-9(2)11(15)14-7-6-13-3/h4-5,8,11,13-15H,1,6-7,12H2,2-3H3/b9-8+,10-5+ |
| InChIKey | AUDGIFBHBILWPZ-VZGHUFTCSA-N |
| XLogP | 0.09 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|