About 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid
2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid (PubChem CID 89399035) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid |
| PubChem CID | 89399035 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid |
| SMILES | COC(=O)C(C(C(=O)O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H24O4/c1-12(2,3)8(10(14)15)9(11(16)17-7)13(4,5)6/h8-9H,1-7H3,(H,14,15) |
| InChIKey | ZYRGOLLCVQYYMN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid?
The IUPAC name of 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid (CID 89399035) is 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid.
What is the SMILES notation for 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid?
The canonical SMILES for 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid is COC(=O)C(C(C(=O)O)C(C)(C)C)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid?
The InChIKey is ZYRGOLLCVQYYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4/c1-12(2,3)8(10(14)15)9(11(16)17-7)13(4,5)6/h8-9H,1-7H3,(H,14,15).
What are the key properties of 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid?
2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid has a molecular weight of 244.33 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3-methoxycarbonyl-4,4-dimethylpentanoic acid is sourced from PubChem (CID 89399035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).