C18H31O3P — CID 89399061
(1E,3E,6E,10Z)-1-diethoxyphosphoryl-3,7-dimethyldodeca-1,3,6,10-tetraene (PubChem CID 89399061) has the molecular formula C18H31O3P and a molecular weight of 326.42 g/mol. Its IUPAC name is (1E,3E,6E,10Z)-1-diethoxyphosphoryl-3,7-dimethyldodeca-1,3,6,10-tetraene.
| Compound Name | (1E,3E,6E,10Z)-1-diethoxyphosphoryl-3,7-dimethyldodeca-1,3,6,10-tetraene |
|---|---|
| PubChem CID | 89399061 |
| Molecular Formula | C18H31O3P |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (1E,3E,6E,10Z)-1-diethoxyphosphoryl-3,7-dimethyldodeca-1,3,6,10-tetraene |
| SMILES | C/C=C\CC/C(C)=C/C/C=C(C)/C=C/P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H31O3P/c1-6-9-10-12-17(4)13-11-14-18(5)15-16-22(19,20-7-2)21-8-3/h6,9,13-16H,7-8,10-12H2,1-5H3/b9-6-,16-15+,17-13+,18-14+ |
| InChIKey | INRSJLWJTAGODH-ORQMURTASA-N |
| XLogP | 6.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|