About (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile
(2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile (PubChem CID 89399523) has the molecular formula C7H9NO
and a molecular weight of 123.16 g/mol. Its IUPAC name is (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile |
| PubChem CID | 89399523 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile |
| SMILES | C=C(/C=C(\C)C#N)CO |
| InChI | InChI=1S/C7H9NO/c1-6(4-8)3-7(2)5-9/h3,9H,2,5H2,1H3/b6-3+ |
| InChIKey | WZTIIUHGGLYGDY-ZZXKWVIFSA-N |
| XLogP | 1.00 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile?
The IUPAC name of (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile (CID 89399523) is (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile.
What is the SMILES notation for (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile?
The canonical SMILES for (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile is C=C(/C=C(\C)C#N)CO.
What is the InChIKey of (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile?
The InChIKey is WZTIIUHGGLYGDY-ZZXKWVIFSA-N. The full InChI is InChI=1S/C7H9NO/c1-6(4-8)3-7(2)5-9/h3,9H,2,5H2,1H3/b6-3+.
What are the key properties of (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile?
(2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile has a molecular weight of 123.16 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-(hydroxymethyl)-2-methylpenta-2,4-dienenitrile is sourced from PubChem (CID 89399523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).