About (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol
(2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol (PubChem CID 89399630) has the molecular formula C12H10Cl2FN3O
and a molecular weight of 302.14 g/mol. Its IUPAC name is (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol.
Molecular Properties
| Compound Name | (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol |
| PubChem CID | 89399630 |
| Molecular Formula | C12H10Cl2FN3O |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol |
| SMILES | OC[C@@H](Nc1nc(Cl)ncc1Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C12H10Cl2FN3O/c13-9-5-16-12(14)18-11(9)17-10(6-19)7-2-1-3-8(15)4-7/h1-5,10,19H,6H2,(H,16,17,18)/t10-/m1/s1 |
| InChIKey | WDJFIKRHBXUCCW-SNVBAGLBSA-N |
| XLogP | 3.07 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol?
The IUPAC name of (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol (CID 89399630) is (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol.
What is the SMILES notation for (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol?
The canonical SMILES for (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol is OC[C@@H](Nc1nc(Cl)ncc1Cl)c1cccc(F)c1.
What is the InChIKey of (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol?
The InChIKey is WDJFIKRHBXUCCW-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H10Cl2FN3O/c13-9-5-16-12(14)18-11(9)17-10(6-19)7-2-1-3-8(15)4-7/h1-5,10,19H,6H2,(H,16,17,18)/t10-/m1/s1.
What are the key properties of (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol?
(2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol has a molecular weight of 302.14 g/mol, XLogP of 3.07, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2,5-dichloropyrimidin-4-yl)amino]-2-(3-fluorophenyl)ethanol is sourced from PubChem (CID 89399630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).