C8BrF6IN2S — CID 89399713
7-bromo-4-iodo-5,6-bis(trifluoromethyl)-2,1,3-benzothiadiazole (PubChem CID 89399713) has the molecular formula C8BrF6IN2S and a molecular weight of 476.97 g/mol. Its IUPAC name is 7-bromo-4-iodo-5,6-bis(trifluoromethyl)-2,1,3-benzothiadiazole.
| Compound Name | 7-bromo-4-iodo-5,6-bis(trifluoromethyl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 89399713 |
| Molecular Formula | C8BrF6IN2S |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 475.79 |
| IUPAC Name | 7-bromo-4-iodo-5,6-bis(trifluoromethyl)-2,1,3-benzothiadiazole |
| SMILES | FC(F)(F)c1c(C(F)(F)F)c(I)c2nsnc2c1Br |
| InChI | InChI=1S/C8BrF6IN2S/c9-3-1(7(10,11)12)2(8(13,14)15)4(16)6-5(3)17-19-18-6 |
| InChIKey | ROTTVOKCQZPCGU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|