C12H11N3 — CID 89399746
4-propan-2-yl-1,5-naphthyridine-3-carbonitrile (PubChem CID 89399746) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-propan-2-yl-1,5-naphthyridine-3-carbonitrile.
| Compound Name | 4-propan-2-yl-1,5-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 89399746 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-propan-2-yl-1,5-naphthyridine-3-carbonitrile |
| SMILES | CC(C)c1c(C#N)cnc2cccnc12 |
| InChI | InChI=1S/C12H11N3/c1-8(2)11-9(6-13)7-15-10-4-3-5-14-12(10)11/h3-5,7-8H,1-2H3 |
| InChIKey | ZFYLEJPLBNBECQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |