C28H48N2O6 — CID 89399915
[(E)-10-[[(2S)-2-[[(E)-10-acetyloxydec-2-enoyl]amino]butyl]amino]-10-oxodec-8-enyl] acetate (PubChem CID 89399915) has the molecular formula C28H48N2O6 and a molecular weight of 508.70 g/mol. Its IUPAC name is [(E)-10-[[(2S)-2-[[(E)-10-acetyloxydec-2-enoyl]amino]butyl]amino]-10-oxodec-8-enyl] acetate.
| Compound Name | [(E)-10-[[(2S)-2-[[(E)-10-acetyloxydec-2-enoyl]amino]butyl]amino]-10-oxodec-8-enyl] acetate |
|---|---|
| PubChem CID | 89399915 |
| Molecular Formula | C28H48N2O6 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.35 |
| IUPAC Name | [(E)-10-[[(2S)-2-[[(E)-10-acetyloxydec-2-enoyl]amino]butyl]amino]-10-oxodec-8-enyl] acetate |
| SMILES | CC[C@@H](CNC(=O)/C=C/CCCCCCCOC(C)=O)NC(=O)/C=C/CCCCCCCOC(C)=O |
| InChI | InChI=1S/C28H48N2O6/c1-4-26(30-28(34)20-16-12-8-6-10-14-18-22-36-25(3)32)23-29-27(33)19-15-11-7-5-9-13-17-21-35-24(2)31/h15-16,19-20,26H,4-14,17-18,21-23H2,1-3H3,(H,29,33)(H,30,34)/b19-15+,20-16+/t26-/m0/s1 |
| InChIKey | ZQPHEVODSQAACS-NKKOYKISSA-N |
| XLogP | 4.92 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|