C23H38O2S — CID 89400204
methyl 2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylacetate (PubChem CID 89400204) has the molecular formula C23H38O2S and a molecular weight of 378.62 g/mol. Its IUPAC name is methyl 2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylacetate.
| Compound Name | methyl 2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylacetate |
|---|---|
| PubChem CID | 89400204 |
| Molecular Formula | C23H38O2S |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | methyl 2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylacetate |
| SMILES | COC(=O)CSC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H38O2S/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-22(5)16-17-26-18-23(24)25-6/h10,12,14,16H,7-9,11,13,15,17-18H2,1-6H3/b20-12+,21-14+,22-16+ |
| InChIKey | LNAPXIZDCATOAK-VOLDSXALSA-N |
| XLogP | 7.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|