C45H32FNO2 — CID 89400226
2-[[6-[[(E,1E)-1-cyclohexa-2,4-dien-1-ylidenepent-2-en-3-yl]-(5-fluoronaphthalen-1-yl)amino]naphthalen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 89400226) has the molecular formula C45H32FNO2 and a molecular weight of 637.75 g/mol. Its IUPAC name is 2-[[6-[[(E,1E)-1-cyclohexa-2,4-dien-1-ylidenepent-2-en-3-yl]-(5-fluoronaphthalen-1-yl)amino]naphthalen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[6-[[(E,1E)-1-cyclohexa-2,4-dien-1-ylidenepent-2-en-3-yl]-(5-fluoronaphthalen-1-yl)amino]naphthalen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 89400226 |
| Molecular Formula | C45H32FNO2 |
| Molecular Weight | 637.75 g/mol |
| Exact Mass | 637.24 |
| IUPAC Name | 2-[[6-[[(E,1E)-1-cyclohexa-2,4-dien-1-ylidenepent-2-en-3-yl]-(5-fluoronaphthalen-1-yl)amino]naphthalen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | CC/C(=C\C=C1\C=CC=CC1)N(c1ccc2cc(C=C3C(=O)c4cc5ccccc5cc4C3=O)ccc2c1)c1cccc2c(F)cccc12 |
| InChI | InChI=1S/C45H32FNO2/c1-2-35(22-19-29-10-4-3-5-11-29)47(43-17-9-14-37-38(43)15-8-16-42(37)46)36-23-21-33-24-30(18-20-34(33)26-36)25-41-44(48)39-27-31-12-6-7-13-32(31)28-40(39)45(41)49/h3-10,12-28H,2,11H2,1H3/b29-19-,35-22+ |
| InChIKey | OTQHHUXREGZISP-NZPOLGONSA-N |
| XLogP | 11.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.75 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|