About 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene
1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene (PubChem CID 89400242) has the molecular formula C11H9Cl3
and a molecular weight of 247.55 g/mol. Its IUPAC name is 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene.
Molecular Properties
| Compound Name | 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene |
| PubChem CID | 89400242 |
| Molecular Formula | C11H9Cl3 |
| Molecular Weight | 247.55 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene |
| SMILES | C=C(Cl)/C=C(\C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H9Cl3/c1-7(5-8(2)12)9-3-4-10(13)11(14)6-9/h3-6H,2H2,1H3/b7-5+ |
| InChIKey | NOODXIOXIPCKEG-FNORWQNLSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 247.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene?
The IUPAC name of 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene (CID 89400242) is 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene.
What is the SMILES notation for 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene?
The canonical SMILES for 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene is C=C(Cl)/C=C(\C)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene?
The InChIKey is NOODXIOXIPCKEG-FNORWQNLSA-N. The full InChI is InChI=1S/C11H9Cl3/c1-7(5-8(2)12)9-3-4-10(13)11(14)6-9/h3-6H,2H2,1H3/b7-5+.
What are the key properties of 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene?
1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene has a molecular weight of 247.55 g/mol, XLogP of 5.15, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-4-[(2E)-4-chloropenta-2,4-dien-2-yl]benzene is sourced from PubChem (CID 89400242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).