About (3-methyloxetan-3-yl)methanol;oxetan-2-ol
(3-methyloxetan-3-yl)methanol;oxetan-2-ol (PubChem CID 89400317) has the molecular formula C8H16O4
and a molecular weight of 176.21 g/mol. Its IUPAC name is (3-methyloxetan-3-yl)methanol;oxetan-2-ol.
Molecular Properties
| Compound Name | (3-methyloxetan-3-yl)methanol;oxetan-2-ol |
| PubChem CID | 89400317 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (3-methyloxetan-3-yl)methanol;oxetan-2-ol |
| SMILES | CC1(CO)COC1.OC1CCO1 |
| InChI | InChI=1S/C5H10O2.C3H6O2/c1-5(2-6)3-7-4-5;4-3-1-2-5-3/h6H,2-4H2,1H3;3-4H,1-2H2 |
| InChIKey | HWPHPBWPQNZUNG-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methyloxetan-3-yl)methanol;oxetan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyloxetan-3-yl)methanol;oxetan-2-ol?
The IUPAC name of (3-methyloxetan-3-yl)methanol;oxetan-2-ol (CID 89400317) is (3-methyloxetan-3-yl)methanol;oxetan-2-ol.
What is the SMILES notation for (3-methyloxetan-3-yl)methanol;oxetan-2-ol?
The canonical SMILES for (3-methyloxetan-3-yl)methanol;oxetan-2-ol is CC1(CO)COC1.OC1CCO1.
What is the InChIKey of (3-methyloxetan-3-yl)methanol;oxetan-2-ol?
The InChIKey is HWPHPBWPQNZUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C3H6O2/c1-5(2-6)3-7-4-5;4-3-1-2-5-3/h6H,2-4H2,1H3;3-4H,1-2H2.
What are the key properties of (3-methyloxetan-3-yl)methanol;oxetan-2-ol?
(3-methyloxetan-3-yl)methanol;oxetan-2-ol has a molecular weight of 176.21 g/mol, XLogP of -0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyloxetan-3-yl)methanol;oxetan-2-ol is sourced from PubChem (CID 89400317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).