About zinc phenylmethanesulfinate
zinc phenylmethanesulfinate (PubChem CID 89401483) has the molecular formula C14H14O4S2Zn
and a molecular weight of 375.79 g/mol. Its IUPAC name is zinc phenylmethanesulfinate.
Molecular Properties
| Compound Name | zinc phenylmethanesulfinate |
| PubChem CID | 89401483 |
| Molecular Formula | C14H14O4S2Zn |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 373.96 |
| IUPAC Name | zinc phenylmethanesulfinate |
| SMILES | O=S([O-])Cc1ccccc1.O=S([O-])Cc1ccccc1.[Zn+2] |
| InChI | InChI=1S/2C7H8O2S.Zn/c2*8-10(9)6-7-4-2-1-3-5-7;/h2*1-5H,6H2,(H,8,9);/q;;+2/p-2 |
| InChIKey | AHSIXHPQMGLVIG-UHFFFAOYSA-L |
| XLogP | 2.13 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze zinc phenylmethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc phenylmethanesulfinate?
The IUPAC name of zinc phenylmethanesulfinate (CID 89401483) is zinc phenylmethanesulfinate.
What is the SMILES notation for zinc phenylmethanesulfinate?
The canonical SMILES for zinc phenylmethanesulfinate is O=S([O-])Cc1ccccc1.O=S([O-])Cc1ccccc1.[Zn+2].
What is the InChIKey of zinc phenylmethanesulfinate?
The InChIKey is AHSIXHPQMGLVIG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H8O2S.Zn/c2*8-10(9)6-7-4-2-1-3-5-7;/h2*1-5H,6H2,(H,8,9);/q;;+2/p-2.
What are the key properties of zinc phenylmethanesulfinate?
zinc phenylmethanesulfinate has a molecular weight of 375.79 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc phenylmethanesulfinate is sourced from PubChem (CID 89401483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).