About 2,8a-dihydronaphthalene-1,8-diimine
2,8a-dihydronaphthalene-1,8-diimine (PubChem CID 89401691) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2,8a-dihydronaphthalene-1,8-diimine.
Molecular Properties
| Compound Name | 2,8a-dihydronaphthalene-1,8-diimine |
| PubChem CID | 89401691 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 2,8a-dihydronaphthalene-1,8-diimine |
| SMILES | [H]/N=C1\C=CC=C2C=CC/C(=N\[H])C21 |
| InChI | InChI=1S/C10H10N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-5,10-12H,6H2/b11-8+,12-9+ |
| InChIKey | PQPFVIUGJMEEQV-HZOWPXDZSA-N |
| XLogP | 2.10 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,8a-dihydronaphthalene-1,8-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8a-dihydronaphthalene-1,8-diimine?
The IUPAC name of 2,8a-dihydronaphthalene-1,8-diimine (CID 89401691) is 2,8a-dihydronaphthalene-1,8-diimine.
What is the SMILES notation for 2,8a-dihydronaphthalene-1,8-diimine?
The canonical SMILES for 2,8a-dihydronaphthalene-1,8-diimine is [H]/N=C1\C=CC=C2C=CC/C(=N\[H])C21.
What is the InChIKey of 2,8a-dihydronaphthalene-1,8-diimine?
The InChIKey is PQPFVIUGJMEEQV-HZOWPXDZSA-N. The full InChI is InChI=1S/C10H10N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-5,10-12H,6H2/b11-8+,12-9+.
What are the key properties of 2,8a-dihydronaphthalene-1,8-diimine?
2,8a-dihydronaphthalene-1,8-diimine has a molecular weight of 158.20 g/mol, XLogP of 2.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8a-dihydronaphthalene-1,8-diimine is sourced from PubChem (CID 89401691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).