C11H22N2O2 — CID 89401756
(2R)-1-tert-butyl-N-methoxy-N-methylpyrrolidine-2-carboxamide (PubChem CID 89401756) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2R)-1-tert-butyl-N-methoxy-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-tert-butyl-N-methoxy-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 89401756 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (2R)-1-tert-butyl-N-methoxy-N-methylpyrrolidine-2-carboxamide |
| SMILES | CON(C)C(=O)[C@H]1CCCN1C(C)(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)13-8-6-7-9(13)10(14)12(4)15-5/h9H,6-8H2,1-5H3/t9-/m1/s1 |
| InChIKey | CHBCBWRMVDQUPF-SECBINFHSA-N |
| XLogP | 1.27 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|