About [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate
[(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate (PubChem CID 89401881) has the molecular formula C11H17ClFN3O3S
and a molecular weight of 325.79 g/mol. Its IUPAC name is [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate.
Molecular Properties
| Compound Name | [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate |
| PubChem CID | 89401881 |
| Molecular Formula | C11H17ClFN3O3S |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate |
| SMILES | CC(C)(C)[C@H](COS(C)(=O)=O)Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C11H17ClFN3O3S/c1-11(2,3)8(6-19-20(4,17)18)15-9-7(13)5-14-10(12)16-9/h5,8H,6H2,1-4H3,(H,14,15,16)/t8-/m0/s1 |
| InChIKey | BGUYNPATMDNWCR-QMMMGPOBSA-N |
| XLogP | 2.07 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate?
The IUPAC name of [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate (CID 89401881) is [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate.
What is the SMILES notation for [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate?
The canonical SMILES for [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate is CC(C)(C)[C@H](COS(C)(=O)=O)Nc1nc(Cl)ncc1F.
What is the InChIKey of [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate?
The InChIKey is BGUYNPATMDNWCR-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H17ClFN3O3S/c1-11(2,3)8(6-19-20(4,17)18)15-9-7(13)5-14-10(12)16-9/h5,8H,6H2,1-4H3,(H,14,15,16)/t8-/m0/s1.
What are the key properties of [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate?
[(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate has a molecular weight of 325.79 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] methanesulfonate is sourced from PubChem (CID 89401881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).