C18H14F7N5O3 — CID 89402093
[1-[3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]-3-fluoroazetidin-3-yl]-methylcarbamic acid (PubChem CID 89402093) has the molecular formula C18H14F7N5O3 and a molecular weight of 481.33 g/mol. Its IUPAC name is [1-[3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]-3-fluoroazetidin-3-yl]-methylcarbamic acid.
| Compound Name | [1-[3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]-3-fluoroazetidin-3-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 89402093 |
| Molecular Formula | C18H14F7N5O3 |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | [1-[3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]prop-2-enoyl]-3-fluoroazetidin-3-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)C1(F)CN(C(=O)C=Cn2cnc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C1 |
| InChI | InChI=1S/C18H14F7N5O3/c1-28(15(32)33)16(19)7-29(8-16)13(31)2-3-30-9-26-14(27-30)10-4-11(17(20,21)22)6-12(5-10)18(23,24)25/h2-6,9H,7-8H2,1H3,(H,32,33) |
| InChIKey | KGDCUWAXTXKHBD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|