C19H29Cl2N3O2Si — CID 89402696
tert-butyl-[(2R,5R)-5-[4-chloro-5-(chloromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-ethyloxolan-3-yl]oxy-dimethylsilane (PubChem CID 89402696) has the molecular formula C19H29Cl2N3O2Si and a molecular weight of 430.45 g/mol. Its IUPAC name is tert-butyl-[(2R,5R)-5-[4-chloro-5-(chloromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-ethyloxolan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,5R)-5-[4-chloro-5-(chloromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-ethyloxolan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 89402696 |
| Molecular Formula | C19H29Cl2N3O2Si |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | tert-butyl-[(2R,5R)-5-[4-chloro-5-(chloromethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2-ethyloxolan-3-yl]oxy-dimethylsilane |
| SMILES | CC[C@H]1O[C@@H](n2cc(CCl)c3c(Cl)ncnc32)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H29Cl2N3O2Si/c1-7-13-14(26-27(5,6)19(2,3)4)8-15(25-13)24-10-12(9-20)16-17(21)22-11-23-18(16)24/h10-11,13-15H,7-9H2,1-6H3/t13-,14?,15-/m1/s1 |
| InChIKey | VYMRHOWPKKKYQE-GIJJTGMTSA-N |
| XLogP | 5.91 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|