About 5-methoxy-1,4-diazocan-5-ol
5-methoxy-1,4-diazocan-5-ol (PubChem CID 89403020) has the molecular formula C7H16N2O2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 5-methoxy-1,4-diazocan-5-ol.
Molecular Properties
| Compound Name | 5-methoxy-1,4-diazocan-5-ol |
| PubChem CID | 89403020 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 5-methoxy-1,4-diazocan-5-ol |
| SMILES | COC1(O)CCCNCCN1 |
| InChI | InChI=1S/C7H16N2O2/c1-11-7(10)3-2-4-8-5-6-9-7/h8-10H,2-6H2,1H3 |
| InChIKey | QGNLTKLJGAZZFE-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-1,4-diazocan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,4-diazocan-5-ol?
The IUPAC name of 5-methoxy-1,4-diazocan-5-ol (CID 89403020) is 5-methoxy-1,4-diazocan-5-ol.
What is the SMILES notation for 5-methoxy-1,4-diazocan-5-ol?
The canonical SMILES for 5-methoxy-1,4-diazocan-5-ol is COC1(O)CCCNCCN1.
What is the InChIKey of 5-methoxy-1,4-diazocan-5-ol?
The InChIKey is QGNLTKLJGAZZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-11-7(10)3-2-4-8-5-6-9-7/h8-10H,2-6H2,1H3.
What are the key properties of 5-methoxy-1,4-diazocan-5-ol?
5-methoxy-1,4-diazocan-5-ol has a molecular weight of 160.22 g/mol, XLogP of -0.75, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,4-diazocan-5-ol is sourced from PubChem (CID 89403020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).