C31H40N8O2 — CID 89403099
1-[7-[1-(3-morpholin-4-ylpropyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]-3-[(3S)-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]pyrrolidin-3-yl]urea (PubChem CID 89403099) has the molecular formula C31H40N8O2 and a molecular weight of 556.72 g/mol. Its IUPAC name is 1-[7-[1-(3-morpholin-4-ylpropyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]-3-[(3S)-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]pyrrolidin-3-yl]urea.
| Compound Name | 1-[7-[1-(3-morpholin-4-ylpropyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]-3-[(3S)-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 89403099 |
| Molecular Formula | C31H40N8O2 |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | 1-[7-[1-(3-morpholin-4-ylpropyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]-3-[(3S)-1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]pyrrolidin-3-yl]urea |
| SMILES | C/C=C\C=C/C=C/CN1CC[C@H](NC(=O)Nc2ccc3ncc(-c4cnn(CCCN5CCOCC5)c4)cc3n2)C1 |
| InChI | InChI=1S/C31H40N8O2/c1-2-3-4-5-6-7-12-38-15-11-27(24-38)34-31(40)36-30-10-9-28-29(35-30)20-25(21-32-28)26-22-33-39(23-26)14-8-13-37-16-18-41-19-17-37/h2-7,9-10,20-23,27H,8,11-19,24H2,1H3,(H2,34,35,36,40)/b3-2-,5-4-,7-6+/t27-/m0/s1 |
| InChIKey | ZAPZIUCJQJMDRS-SJEZMXGSSA-N |
| XLogP | 4.10 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|