C68H58F6O6S2 — CID 89403248
[3,6-bis(8,11-ditert-butylperylen-3-yl)-7-(trifluoromethylsulfonyloxy)naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 89403248) has the molecular formula C68H58F6O6S2 and a molecular weight of 1149.33 g/mol. Its IUPAC name is [3,6-bis(8,11-ditert-butylperylen-3-yl)-7-(trifluoromethylsulfonyloxy)naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [3,6-bis(8,11-ditert-butylperylen-3-yl)-7-(trifluoromethylsulfonyloxy)naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89403248 |
| Molecular Formula | C68H58F6O6S2 |
| Molecular Weight | 1149.33 g/mol |
| Exact Mass | 1148.36 |
| IUPAC Name | [3,6-bis(8,11-ditert-butylperylen-3-yl)-7-(trifluoromethylsulfonyloxy)naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)c1cc2cc(C(C)(C)C)cc3c4ccc(-c5cc6cc(-c7ccc8c9cc(C(C)(C)C)cc%10cc(C(C)(C)C)cc(c%11cccc7c%118)c%109)c(OS(=O)(=O)C(F)(F)F)cc6cc5OS(=O)(=O)C(F)(F)F)c5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C68H58F6O6S2/c1-63(2,3)39-23-37-25-41(65(7,8)9)33-55-49-21-19-43(45-15-13-17-47(61(45)49)53(31-39)59(37)55)51-27-35-28-52(58(80-82(77,78)68(72,73)74)30-36(35)29-57(51)79-81(75,76)67(69,70)71)44-20-22-50-56-34-42(66(10,11)12)26-38-24-40(64(4,5)6)32-54(60(38)56)48-18-14-16-46(44)62(48)50/h13-34H,1-12H3 |
| InChIKey | YAHNNFNAPHDVGM-UHFFFAOYSA-N |
| XLogP | 19.92 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1149.33 |
| LogP ≤ 5 | 19.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|