About 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile
4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile (PubChem CID 89403426) has the molecular formula C9H4ClF6N
and a molecular weight of 275.58 g/mol. Its IUPAC name is 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile |
| PubChem CID | 89403426 |
| Molecular Formula | C9H4ClF6N |
| Molecular Weight | 275.58 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile |
| SMILES | N#CC1=CC(C(F)(F)F)C(Cl)C(C(F)(F)F)=C1 |
| InChI | InChI=1S/C9H4ClF6N/c10-7-5(8(11,12)13)1-4(3-17)2-6(7)9(14,15)16/h1-2,5,7H |
| InChIKey | KNDVXXZGWDLMMO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile?
The IUPAC name of 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile (CID 89403426) is 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile.
What is the SMILES notation for 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile?
The canonical SMILES for 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile is N#CC1=CC(C(F)(F)F)C(Cl)C(C(F)(F)F)=C1.
What is the InChIKey of 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile?
The InChIKey is KNDVXXZGWDLMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF6N/c10-7-5(8(11,12)13)1-4(3-17)2-6(7)9(14,15)16/h1-2,5,7H.
What are the key properties of 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile?
4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile has a molecular weight of 275.58 g/mol, XLogP of 3.72, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,5-bis(trifluoromethyl)cyclohexa-1,5-diene-1-carbonitrile is sourced from PubChem (CID 89403426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).