C16H30F2O5S — CID 89404275
1,1-difluoro-2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethanesulfonic acid (PubChem CID 89404275) has the molecular formula C16H30F2O5S and a molecular weight of 372.47 g/mol. Its IUPAC name is 1,1-difluoro-2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 89404275 |
| Molecular Formula | C16H30F2O5S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1,1-difluoro-2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxyethanesulfonic acid |
| SMILES | CCC(C)(C)CC(C)(C(=O)OCC(F)(F)S(=O)(=O)O)C(C)(C)CC |
| InChI | InChI=1S/C16H30F2O5S/c1-8-13(3,4)10-15(7,14(5,6)9-2)12(19)23-11-16(17,18)24(20,21)22/h8-11H2,1-7H3,(H,20,21,22) |
| InChIKey | IZDVQMRPLNFGAT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|