About 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine
7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine (PubChem CID 89404557) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine |
| PubChem CID | 89404557 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine |
| SMILES | Cc1nc2cc(C3CC3)ccn2c1C |
| InChI | InChI=1S/C12H14N2/c1-8-9(2)14-6-5-11(10-3-4-10)7-12(14)13-8/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | DROMEHHMOGHMCQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine?
The IUPAC name of 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine (CID 89404557) is 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine.
What is the SMILES notation for 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine?
The canonical SMILES for 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine is Cc1nc2cc(C3CC3)ccn2c1C.
What is the InChIKey of 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine?
The InChIKey is DROMEHHMOGHMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-8-9(2)14-6-5-11(10-3-4-10)7-12(14)13-8/h5-7,10H,3-4H2,1-2H3.
What are the key properties of 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine?
7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine has a molecular weight of 186.26 g/mol, XLogP of 2.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopropyl-2,3-dimethylimidazo[1,2-a]pyridine is sourced from PubChem (CID 89404557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).