C9H13BO3 — CID 89404619
(E)-4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)but-3-en-2-one (PubChem CID 89404619) has the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. Its IUPAC name is (E)-4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)but-3-en-2-one.
| Compound Name | (E)-4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 89404619 |
| Molecular Formula | C9H13BO3 |
| Molecular Weight | 180.01 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (E)-4-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)but-3-en-2-one |
| SMILES | C=C1OB(/C=C/C(C)=O)OC1(C)C |
| InChI | InChI=1S/C9H13BO3/c1-7(11)5-6-10-12-8(2)9(3,4)13-10/h5-6H,2H2,1,3-4H3/b6-5+ |
| InChIKey | GISNNTRTLHGZQT-AATRIKPKSA-N |
| XLogP | 1.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.01 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|