About (4-ethylcyclohexa-2,4-dien-1-yl)methanimine
(4-ethylcyclohexa-2,4-dien-1-yl)methanimine (PubChem CID 89404715) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is (4-ethylcyclohexa-2,4-dien-1-yl)methanimine.
Molecular Properties
| Compound Name | (4-ethylcyclohexa-2,4-dien-1-yl)methanimine |
| PubChem CID | 89404715 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (4-ethylcyclohexa-2,4-dien-1-yl)methanimine |
| SMILES | [H]/N=C/C1C=CC(CC)=CC1 |
| InChI | InChI=1S/C9H13N/c1-2-8-3-5-9(7-10)6-4-8/h3-5,7,9-10H,2,6H2,1H3/b10-7+ |
| InChIKey | AIFSILROPKFHIT-JXMROGBWSA-N |
| XLogP | 2.55 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylcyclohexa-2,4-dien-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylcyclohexa-2,4-dien-1-yl)methanimine?
The IUPAC name of (4-ethylcyclohexa-2,4-dien-1-yl)methanimine (CID 89404715) is (4-ethylcyclohexa-2,4-dien-1-yl)methanimine.
What is the SMILES notation for (4-ethylcyclohexa-2,4-dien-1-yl)methanimine?
The canonical SMILES for (4-ethylcyclohexa-2,4-dien-1-yl)methanimine is [H]/N=C/C1C=CC(CC)=CC1.
What is the InChIKey of (4-ethylcyclohexa-2,4-dien-1-yl)methanimine?
The InChIKey is AIFSILROPKFHIT-JXMROGBWSA-N. The full InChI is InChI=1S/C9H13N/c1-2-8-3-5-9(7-10)6-4-8/h3-5,7,9-10H,2,6H2,1H3/b10-7+.
What are the key properties of (4-ethylcyclohexa-2,4-dien-1-yl)methanimine?
(4-ethylcyclohexa-2,4-dien-1-yl)methanimine has a molecular weight of 135.21 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylcyclohexa-2,4-dien-1-yl)methanimine is sourced from PubChem (CID 89404715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).