About 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole
3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole (PubChem CID 89404741) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole.
Molecular Properties
| Compound Name | 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole |
| PubChem CID | 89404741 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole |
| SMILES | CC/C=C\c1c(C)c[nH]c1C |
| InChI | InChI=1S/C10H15N/c1-4-5-6-10-8(2)7-11-9(10)3/h5-7,11H,4H2,1-3H3/b6-5- |
| InChIKey | MFTXQGVZSDHHML-WAYWQWQTSA-N |
| XLogP | 3.05 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole?
The IUPAC name of 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole (CID 89404741) is 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole.
What is the SMILES notation for 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole?
The canonical SMILES for 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole is CC/C=C\c1c(C)c[nH]c1C.
What is the InChIKey of 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole?
The InChIKey is MFTXQGVZSDHHML-WAYWQWQTSA-N. The full InChI is InChI=1S/C10H15N/c1-4-5-6-10-8(2)7-11-9(10)3/h5-7,11H,4H2,1-3H3/b6-5-.
What are the key properties of 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole?
3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole has a molecular weight of 149.24 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-but-1-enyl]-2,4-dimethyl-1H-pyrrole is sourced from PubChem (CID 89404741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).