C24H25N5O2S — CID 89404811
3,4-dihydro-2H-chromen-3-yl-[4-[4-(pyrimidin-4-ylamino)sulfanylphenyl]piperazin-1-yl]methanone (PubChem CID 89404811) has the molecular formula C24H25N5O2S and a molecular weight of 447.56 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-3-yl-[4-[4-(pyrimidin-4-ylamino)sulfanylphenyl]piperazin-1-yl]methanone.
| Compound Name | 3,4-dihydro-2H-chromen-3-yl-[4-[4-(pyrimidin-4-ylamino)sulfanylphenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 89404811 |
| Molecular Formula | C24H25N5O2S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 3,4-dihydro-2H-chromen-3-yl-[4-[4-(pyrimidin-4-ylamino)sulfanylphenyl]piperazin-1-yl]methanone |
| SMILES | O=C(C1COc2ccccc2C1)N1CCN(c2ccc(SNc3ccncn3)cc2)CC1 |
| InChI | InChI=1S/C24H25N5O2S/c30-24(19-15-18-3-1-2-4-22(18)31-16-19)29-13-11-28(12-14-29)20-5-7-21(8-6-20)32-27-23-9-10-25-17-26-23/h1-10,17,19H,11-16H2,(H,25,26,27) |
| InChIKey | KGEIXBBFBGFIBY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|