C22H29N3O4Si — CID 89404958
(2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 89404958) has the molecular formula C22H29N3O4Si and a molecular weight of 427.58 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 89404958 |
| Molecular Formula | C22H29N3O4Si |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(diphenyl)silyl]-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CC(C)(C)[Si](c1ccccc1)(c1ccccc1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C22H29N3O4Si/c1-22(2,3)30(15-10-6-4-7-11-15,16-12-8-5-9-13-16)21-18(24-25-23)20(28)19(27)17(14-26)29-21/h4-13,17-21,26-28H,14H2,1-3H3/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | ODPCGAJKZDHANX-ONUIULTDSA-N |
| XLogP | 1.75 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|