C47H37N3P2 — CID 89405013
4,7-bis(diphenylphosphanyl)-16-azapentacyclo[16.3.1.110,14.05,21.06,11]tricosa-1(21),2,4,6,8,10,12,14(23),18(22),19-decaene-16-carboximidamide (PubChem CID 89405013) has the molecular formula C47H37N3P2 and a molecular weight of 705.78 g/mol. Its IUPAC name is 4,7-bis(diphenylphosphanyl)-16-azapentacyclo[16.3.1.110,14.05,21.06,11]tricosa-1(21),2,4,6,8,10,12,14(23),18(22),19-decaene-16-carboximidamide.
| Compound Name | 4,7-bis(diphenylphosphanyl)-16-azapentacyclo[16.3.1.110,14.05,21.06,11]tricosa-1(21),2,4,6,8,10,12,14(23),18(22),19-decaene-16-carboximidamide |
|---|---|
| PubChem CID | 89405013 |
| Molecular Formula | C47H37N3P2 |
| Molecular Weight | 705.78 g/mol |
| Exact Mass | 705.25 |
| IUPAC Name | 4,7-bis(diphenylphosphanyl)-16-azapentacyclo[16.3.1.110,14.05,21.06,11]tricosa-1(21),2,4,6,8,10,12,14(23),18(22),19-decaene-16-carboximidamide |
| SMILES | [H]/N=C(\N)N1Cc2ccc3c(c(P(c4ccccc4)c4ccccc4)ccc3c2)-c2c(P(c3ccccc3)c3ccccc3)ccc3cc(ccc23)C1 |
| InChI | InChI=1S/C47H37N3P2/c48-47(49)50-31-33-21-25-41-35(29-33)23-27-43(51(37-13-5-1-6-14-37)38-15-7-2-8-16-38)45(41)46-42-26-22-34(32-50)30-36(42)24-28-44(46)52(39-17-9-3-10-18-39)40-19-11-4-12-20-40/h1-30H,31-32H2,(H3,48,49) |
| InChIKey | JRLGKFCIJIHFHL-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.78 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|