C15H11BF3N2O4S- — CID 89405163
[1-(benzenesulfonyl)-5-methoxycarbonylpyrrolo[2,3-b]pyridin-3-yl]-trifluoroboranuide (PubChem CID 89405163) has the molecular formula C15H11BF3N2O4S- and a molecular weight of 383.14 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-5-methoxycarbonylpyrrolo[2,3-b]pyridin-3-yl]-trifluoroboranuide.
| Compound Name | [1-(benzenesulfonyl)-5-methoxycarbonylpyrrolo[2,3-b]pyridin-3-yl]-trifluoroboranuide |
|---|---|
| PubChem CID | 89405163 |
| Molecular Formula | C15H11BF3N2O4S- |
| Molecular Weight | 383.14 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | [1-(benzenesulfonyl)-5-methoxycarbonylpyrrolo[2,3-b]pyridin-3-yl]-trifluoroboranuide |
| SMILES | COC(=O)c1cnc2c(c1)c([B-](F)(F)F)cn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H11BF3N2O4S/c1-25-15(22)10-7-12-13(16(17,18)19)9-21(14(12)20-8-10)26(23,24)11-5-3-2-4-6-11/h2-9H,1H3/q-1 |
| InChIKey | UEOFZQFAHOTCOX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.14 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|