2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid

C10H3F4NO2 — CID 89405416

IUPAC2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid
SMILESN#CC(=Cc1c(F)c(F)cc(F)c1F)C(=O)O
InChIInChI=1S/C10H3F4NO2/c11-6-2-7(12)9(14)5(8(6)13)1-4(3-15)10(16)17/h1-2H,(H,16,17)
InChIKeyYSWSXLZPHWDMME-UHFFFAOYSA-N
MW245.13 g/mol
LogP2.23
Rot. Bonds2

About 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid

2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid (PubChem CID 89405416) has the molecular formula C10H3F4NO2 and a molecular weight of 245.13 g/mol. Its IUPAC name is 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid.

Molecular Properties

Compound Name2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid
PubChem CID89405416
Molecular FormulaC10H3F4NO2
Molecular Weight245.13 g/mol
Exact Mass245.01
IUPAC Name2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid
SMILESN#CC(=Cc1c(F)c(F)cc(F)c1F)C(=O)O
InChIInChI=1S/C10H3F4NO2/c11-6-2-7(12)9(14)5(8(6)13)1-4(3-15)10(16)17/h1-2H,(H,16,17)
InChIKeyYSWSXLZPHWDMME-UHFFFAOYSA-N
XLogP2.23
TPSA61.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.13
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid?
The IUPAC name of 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid (CID 89405416) is 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid.
What is the SMILES notation for 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid?
The canonical SMILES for 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid is N#CC(=Cc1c(F)c(F)cc(F)c1F)C(=O)O.
What is the InChIKey of 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid?
The InChIKey is YSWSXLZPHWDMME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H3F4NO2/c11-6-2-7(12)9(14)5(8(6)13)1-4(3-15)10(16)17/h1-2H,(H,16,17).
What are the key properties of 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid?
2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid has a molecular weight of 245.13 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-3-(2,3,5,6-tetrafluorophenyl)prop-2-enoic acid is sourced from PubChem (CID 89405416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).