C10H10F8O — CID 89405455
4,4,5,5-tetrafluoro-1-(4,4,5,5-tetrafluoropent-2-enoxy)pent-2-ene (PubChem CID 89405455) has the molecular formula C10H10F8O and a molecular weight of 298.17 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoro-1-(4,4,5,5-tetrafluoropent-2-enoxy)pent-2-ene.
| Compound Name | 4,4,5,5-tetrafluoro-1-(4,4,5,5-tetrafluoropent-2-enoxy)pent-2-ene |
|---|---|
| PubChem CID | 89405455 |
| Molecular Formula | C10H10F8O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4,4,5,5-tetrafluoro-1-(4,4,5,5-tetrafluoropent-2-enoxy)pent-2-ene |
| SMILES | FC(F)C(F)(F)C=CCOCC=CC(F)(F)C(F)F |
| InChI | InChI=1S/C10H10F8O/c11-7(12)9(15,16)3-1-5-19-6-2-4-10(17,18)8(13)14/h1-4,7-8H,5-6H2 |
| InChIKey | IGQGRKHGDCNWTP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|