About [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate
[(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate (PubChem CID 89405614) has the molecular formula C5H10N2O3
and a molecular weight of 146.15 g/mol. Its IUPAC name is [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate.
Molecular Properties
| Compound Name | [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate |
| PubChem CID | 89405614 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate |
| SMILES | NC(=O)O[C@H]1CNC[C@@H]1O |
| InChI | InChI=1S/C5H10N2O3/c6-5(9)10-4-2-7-1-3(4)8/h3-4,7-8H,1-2H2,(H2,6,9)/t3-,4-/m0/s1 |
| InChIKey | BFTVBDZURFVGJB-IMJSIDKUSA-N |
| XLogP | -1.59 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate?
The IUPAC name of [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate (CID 89405614) is [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate.
What is the SMILES notation for [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate?
The canonical SMILES for [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate is NC(=O)O[C@H]1CNC[C@@H]1O.
What is the InChIKey of [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate?
The InChIKey is BFTVBDZURFVGJB-IMJSIDKUSA-N. The full InChI is InChI=1S/C5H10N2O3/c6-5(9)10-4-2-7-1-3(4)8/h3-4,7-8H,1-2H2,(H2,6,9)/t3-,4-/m0/s1.
What are the key properties of [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate?
[(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate has a molecular weight of 146.15 g/mol, XLogP of -1.59, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-4-hydroxypyrrolidin-3-yl] carbamate is sourced from PubChem (CID 89405614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).